* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-CHLORO-3-ETHYL-1H-INDOLE |
| CAS: | 259865-75-3 |
| English Synonyms: | 5-CHLORO-3-ETHYL-1H-INDOLE |
| MDL Number.: | MFCD12924612 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCc1c[nH]c2c1cc(cc2)Cl |
| InChi: | InChI=1S/C10H10ClN/c1-2-7-6-12-10-4-3-8(11)5-9(7)10/h3-6,12H,2H2,1H3 |
| InChiKey: | InChIKey=PPVWRPHKIVQIQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.