* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIVERCHIM DIV02674 |
| CAS: | 21853-84-9 |
| English Synonyms: | DIVERCHIM DIV02674 |
| MDL Number.: | MFCD12963704 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC(=O)OCC(=O)[C@]12C(O1)C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)OC(=O)C)C)C |
| InChi: | InChI=1S/C25H34O6/c1-14(26)29-13-21(28)25-22(31-25)12-20-18-6-5-16-11-17(30-15(2)27)7-9-23(16,3)19(18)8-10-24(20,25)4/h5,17-20,22H,6-13H2,1-4H3/t17-,18+,19-,20-,22?,23-,24-,25+/m0/s1 |
| InChiKey: | InChIKey=NXUKBSFOBDNZBG-GNLDXTQFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.