* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PAQ-22 |
| CAS: | 371968-89-7 |
| English Synonyms: | PAQ-22 |
| MDL Number.: | MFCD12964983 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1cccc(c1n2c(=O)c3ccccc3[nH]c2=O)CC |
| InChi: | InChI=1S/C18H18N2O2/c1-3-12-8-7-9-13(4-2)16(12)20-17(21)14-10-5-6-11-15(14)19-18(20)22/h5-11H,3-4H2,1-2H3,(H,19,22) |
| InChiKey: | InChIKey=HJBJGSGWHRZAFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.