Molecular Structure:
CCD No.:CCD01967141
PYROCATECHOL-3,4,5,6-D4
CAS No.:
103963-58-2
Formula:C6 H2 D4 O2
MolWeight:114.136
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | PYROCATECHOL-3,4,5,6-D4 |
| CAS： | 103963-58-2 |
| English Synonyms： | PYROCATECHOL-3,4,5,6-D4 |
| MDL Number.： | MFCD12964984 |
| H bond acceptor： | 2 |
| H bond donor： | 2 |
| Smile： | [2H]c1c(c(c(c(c1[2H])O)O)[2H])[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
