* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | POTASSIUM 2-[(4E,6E,10E)-(2S,3R,12S)-13-(4-FLUORO-PHENOXY)-2,3,12-TRIHYDROXY-TRIDECA-4,6,10-TRIEN-8-YNYLOXY]ACETATE |
| English Synonyms: | POTASSIUM 2-[(4E,6E,10E)-(2S,3R,12S)-13-(4-FLUORO-PHENOXY)-2,3,12-TRIHYDROXY-TRIDECA-4,6,10-TRIEN-8-YNYLOXY]ACETATE |
| MDL Number.: | MFCD13151889 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1cc(ccc1OC[C@H](/C=C/C#C/C=C/C=C/[C@H]([C@H](COCC(=O)[O-])O)O)O)F.[K+] |
| InChi: | InChI=1S/C21H23FO7.K/c22-16-9-11-18(12-10-16)29-13-17(23)7-5-3-1-2-4-6-8-19(24)20(25)14-28-15-21(26)27;/h2,4-12,17,19-20,23-25H,13-15H2,(H,26,27);/q;+1/p-1/b4-2+,7-5+,8-6+;/t17-,19+,20-;/m0./s1 |
| InChiKey: | InChIKey=SSNGRCVTRMPEKF-ILCIQDJASA-M |
* If the product has intellectual property rights, a license granted is must or contact us.