* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PSN-9301 |
English Synonyms: | PSN-9301 |
MDL Number.: | MFCD13152363 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC[C@H](C)[C@H](C)C(=O)N1CCSC1.CC[C@H](C)[C@H](C)C(=O)N1CCSC1.C(=C/C(=O)O)\C(=O)O |
InChi: | InChI=1S/2C10H19NOS.C4H4O4/c2*1-4-8(2)9(3)10(12)11-5-6-13-7-11;5-3(6)1-2-4(7)8/h2*8-9H,4-7H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*8-,9-;/m00./s1 |
InChiKey: | InChIKey=XBVIFQMERPFQEM-SRNJLZAZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.