* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KP-1461 |
| English Synonyms: | KP-1461 |
| MDL Number.: | MFCD13152386 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | CCCCCCCOC(=O)NC1=NC(=O)N(CN1)C2CC(C(O2)CO)O |
| InChi: | InChI=1S/C16H28N4O6/c1-2-3-4-5-6-7-25-16(24)19-14-17-10-20(15(23)18-14)13-8-11(22)12(9-21)26-13/h11-13,21-22H,2-10H2,1H3,(H2,17,18,19,23,24) |
| InChiKey: | InChIKey=SZWIAFVYPPMZML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.