* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SB-705498 |
| CAS: | 501951-42-4 |
| English Synonyms: | SB-705498 ; SB705498 ; 1-(2-BROMOPHENYL)-3-[(3R)-1-[5-(TRIFLUOROMETHYL)PYRIDIN-2-YL]PYRROLIDIN-3-YL]UREA |
| MDL Number.: | MFCD13152399 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)NC(=O)N[C@@H]2CCN(C2)c3ccc(cn3)C(F)(F)F)Br |
| InChi: | InChI=1S/C17H16BrF3N4O/c18-13-3-1-2-4-14(13)24-16(26)23-12-7-8-25(10-12)15-6-5-11(9-22-15)17(19,20)21/h1-6,9,12H,7-8,10H2,(H2,23,24,26)/t12-/m1/s1 |
| InChiKey: | InChIKey=JYILLRHXRVTRSH-GFCCVEGCSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.