* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | PIPERIDINE, 1-(2-FLUORO-3-METHYL-1-OXO-4-PENTENYL)-, (R*,R*)- |
CAS: | 174649-72-0 |
English Synonyms: | PIPERIDINE, 1-(2-FLUORO-3-METHYL-1-OXO-4-PENTENYL)-, (R*,R*)- |
MDL Number.: | MFCD13172882 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C[C@H](C=C)[C@H](C(=O)N1CCCCC1)F |
InChi: | InChI=1S/C11H18FNO/c1-3-9(2)10(12)11(14)13-7-5-4-6-8-13/h3,9-10H,1,4-8H2,2H3/t9-,10-/m1/s1 |
InChiKey: | InChIKey=UESSHCNYURVSGZ-NXEZZACHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.