* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRROLIDINE, 1-(2-FLUORO-3-HYDROXY-4-METHYL-1-OXOPENTYL)-, (R*,S*)- |
| CAS: | 99343-25-6 |
| English Synonyms: | PYRROLIDINE, 1-(2-FLUORO-3-HYDROXY-4-METHYL-1-OXOPENTYL)-, (R*,S*)- |
| MDL Number.: | MFCD13172959 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)[C@@H]([C@H](C(=O)N1CCCC1)F)O |
| InChi: | InChI=1S/C10H18FNO2/c1-7(2)9(13)8(11)10(14)12-5-3-4-6-12/h7-9,13H,3-6H2,1-2H3/t8-,9+/m1/s1 |
| InChiKey: | InChIKey=NQUNYPFOXVCJIX-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.