* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOXAZOLO[3,4-C]PYRIDINE |
| CAS: | 70899-00-2 |
| English Synonyms: | ISOXAZOLO[3,4-C]PYRIDINE ; [1,2]OXAZOLO[3,4-C]PYRIDINE |
| MDL Number.: | MFCD13175216 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cncc2c1con2 |
| InChi: | InChI=1S/C6H4N2O/c1-2-7-3-6-5(1)4-9-8-6/h1-4H |
| InChiKey: | InChIKey=LYJQKVHNCAMDPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.