* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOXAZOLO[3,4-B]PYRIDINE |
| CAS: | 51130-67-7 |
| English Synonyms: | [1,2]OXAZOLO[3,4-B]PYRIDINE ; ISOXAZOLO[3,4-B]PYRIDINE |
| MDL Number.: | MFCD13175224 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc2conc2nc1 |
| InChi: | InChI=1S/C6H4N2O/c1-2-5-4-9-8-6(5)7-3-1/h1-4H |
| InChiKey: | InChIKey=FEPXOWICZHILLB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.