* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3H-PYRROLO[3,2-C]PYRIDINE |
| CAS: | 271-33-0 |
| English Synonyms: | 3H-PYRROLO[3,2-C]PYRIDINE |
| MDL Number.: | MFCD13175324 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cncc2c1N=CC2 |
| InChi: | InChI=1S/C7H6N2/c1-4-9-7-2-3-8-5-6(1)7/h2-5H,1H2 |
| InChiKey: | InChIKey=DXQVHYJTSXAFJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.