* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRIDINE, 3-NITRO-, HYDRATE |
CAS: | 354527-68-7 |
English Synonyms: | PYRIDINE, 3-NITRO-, HYDRATE |
MDL Number.: | MFCD13175443 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc(cnc1)[N+](=O)[O-].O |
InChi: | InChI=1S/C5H4N2O2.H2O/c8-7(9)5-2-1-3-6-4-5;/h1-4H;1H2 |
InChiKey: | InChIKey=XMSYFUCTCMUJEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.