* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRIDO[2,3-C]PYRIDAZINE |
| CAS: | 6133-99-9 |
| English Synonyms: | PYRIDO[2,3-C]PYRIDAZINE |
| MDL Number.: | MFCD13175873 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc2ccnnc2nc1 |
| InChi: | InChI=1S/C7H5N3/c1-2-6-3-5-9-10-7(6)8-4-1/h1-5H |
| InChiKey: | InChIKey=BEJXOECDIXUTLN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.