* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRIDO[2,3-D]-1,2,3-TRIAZINE |
| CAS: | 6133-40-0 |
| English Synonyms: | PYRIDO[2,3-D]-1,2,3-TRIAZINE |
| MDL Number.: | MFCD13175877 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc2cnnnc2nc1 |
| InChi: | InChI=1S/C6H4N4/c1-2-5-4-8-10-9-6(5)7-3-1/h1-4H |
| InChiKey: | InChIKey=KNCXKNGZYFKVMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.