* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOQUINOLINE, 1,2,3,4,4A,5,8,8A-OCTAHYDRO-, (4AR-CIS) |
| CAS: | 132883-50-2 |
| English Synonyms: | ISOQUINOLINE, 1,2,3,4,4A,5,8,8A-OCTAHYDRO-, (4AR-CIS) |
| MDL Number.: | MFCD13176268 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C1CNC[C@H]2[C@@H]1CC=CC2 |
| InChi: | InChI=1S/C9H15N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-2,8-10H,3-7H2/t8-,9+/m1/s1 |
| InChiKey: | InChIKey=MRFFJAWHKNQAGF-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.