* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMIDAZO[1,2-A]PYRIDINE-8-THIOL |
| CAS: | 101389-20-2 |
| English Synonyms: | IMIDAZO[1,2-A]PYRIDINE-8-THIOL |
| MDL Number.: | MFCD13176752 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc(c2nccn2c1)S |
| InChi: | InChI=1S/C7H6N2S/c10-6-2-1-4-9-5-3-8-7(6)9/h1-5,10H |
| InChiKey: | InChIKey=RHDFYFLHLNHILO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.