* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRROLO[1,2-A]QUINOLINE |
CAS: | 317-17-9 |
English Synonyms: | PYRROLO[1,2-A]QUINOLINE |
MDL Number.: | MFCD13178671 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)ccc3n2ccc3 |
InChi: | InChI=1S/C12H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-13(11)12/h1-9H |
InChiKey: | InChIKey=XLIQPEZVRBALDD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.