* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-PYRROLO[1,2-A]INDOL-9-ONE |
CAS: | 525-24-6 |
English Synonyms: | 9H-PYRROLO[1,2-A]INDOL-9-ONE ; 3A-AZA-CYCLOPENTA[A]INDEN-8-ONE |
MDL Number.: | MFCD13178674 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc-2c(c1)C(=O)c3n2ccc3 |
InChi: | InChI=1S/C11H7NO/c13-11-8-4-1-2-5-9(8)12-7-3-6-10(11)12/h1-7H |
InChiKey: | InChIKey=DEFXDSGVNUQNJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.