* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,5,6,7-TETRAHYDRO-1H-[1,2,3]OXADIAZOLO[3,4-A]PYRIDINE |
CAS: | 623564-48-7 |
English Synonyms: | 4,5,6,7-TETRAHYDRO-1H-[1,2,3]OXADIAZOLO[3,4-A]PYRIDINE |
MDL Number.: | MFCD13178730 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1CCN2C(=CON2)C1 |
InChi: | InChI=1S/C6H10N2O/c1-2-4-8-6(3-1)5-9-7-8/h5,7H,1-4H2 |
InChiKey: | InChIKey=IWMQDGUMJDDQCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.