* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-3,9-DIAZABICYCLO[3.3.1]NONANE |
CAS: | 90152-00-4 |
English Synonyms: | 9-METHYL-3,9-DIAZABICYCLO[3.3.1]NONANE |
MDL Number.: | MFCD13178790 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CN1[C@@H]2CCC[C@H]1CNC2 |
InChi: | InChI=1S/C8H16N2/c1-10-7-3-2-4-8(10)6-9-5-7/h7-9H,2-6H2,1H3/t7-,8+ |
InChiKey: | InChIKey=NHNRLASXGHTJKZ-OCAPTIKFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.