* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOXAZOLO[5,4-C]PYRIDIN-3(2H)-ONE |
| CAS: | 847996-42-3 |
| English Synonyms: | ISOXAZOLO[5,4-C]PYRIDIN-3(2H)-ONE |
| MDL Number.: | MFCD13181755 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cncc2c1c(=O)[nH]o2 |
| InChi: | InChI=1S/C6H4N2O2/c9-6-4-1-2-7-3-5(4)10-8-6/h1-3H,(H,8,9) |
| InChiKey: | InChIKey=CRAFYPVJLKTWET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.