* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PHENOL, 2-(1H-IMIDAZOL-2-YL)-, 1-ACETATE |
CAS: | 52755-84-7 |
English Synonyms: | PHENOL, 2-(1H-IMIDAZOL-2-YL)-, 1-ACETATE |
MDL Number.: | MFCD13183259 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(=O)Oc1ccccc1c2[nH]ccn2 |
InChi: | InChI=1S/C11H10N2O2/c1-8(14)15-10-5-3-2-4-9(10)11-12-6-7-13-11/h2-7H,1H3,(H,12,13) |
InChiKey: | InChIKey=MQIQLEPEEIJBGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.