* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-PYRROLO[2,3-B:5,4-B']DIPYRIDINE |
CAS: | 17966-00-6 |
English Synonyms: | 9H-PYRROLO[2,3-B:5,4-B']DIPYRIDINE |
MDL Number.: | MFCD13183872 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c3ccncc3[nH]c2nc1 |
InChi: | InChI=1S/C10H7N3/c1-2-8-7-3-5-11-6-9(7)13-10(8)12-4-1/h1-6H,(H,12,13) |
InChiKey: | InChIKey=HZIDRGNLSOMQRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.