Molecular Structure:
CCD No.:CCD02000571
WAY 151616
CAS No.:
202520-55-6
Formula:C16 H18 Cl2 N2 O2
MolWeight:341.236
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | WAY 151616 |
| CAS： | 202520-55-6 |
| English Synonyms： | WAY 151616 |
| MDL Number.： | MFCD13185165 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | CCC(C)(C)Nc1c(c(=O)c1=O)NCc2ccc(cc2Cl)Cl |
| InChi： | InChI=1S/C16H18Cl2N2O2/c1-4-16(2,3)20-13-12(14(21)15(13)22)19-8-9-5-6-10(17)7-11(9)18/h5-7,19-20H,4,8H2,1-3H3 |
| InChiKey： | InChIKey=HOBFPLODOGEFCN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
