* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PRADEFOVIR |
| CAS: | 625095-60-5 |
| English Synonyms: | PRADEFOVIR |
| MDL Number.: | MFCD13185167 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | c1cc(cc(c1)Cl)[C@@H]2CCOP(=O)(O2)COCCn3cnc4c3ncnc4N |
| InChi: | InChI=1S/C17H19ClN5O4P/c18-13-3-1-2-12(8-13)14-4-6-26-28(24,27-14)11-25-7-5-23-10-22-15-16(19)20-9-21-17(15)23/h1-3,8-10,14H,4-7,11H2,(H2,19,20,21)/t14-,28?/m0/s1 |
| InChiKey: | InChIKey=GWNHAOBXDGOXRR-DCXKMBIZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.