* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BESTIPHARMA 520-809 |
| English Synonyms: | BESTIPHARMA 520-809 |
| MDL Number.: | MFCD13188564 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C1CC1c2nc([nH]n2)Br |
| InChi: | InChI=1S/C5H6BrN3/c6-5-7-4(8-9-5)3-1-2-3/h3H,1-2H2,(H,7,8,9) |
| InChiKey: | InChIKey=CWTBMXDHWRHCQT-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.