* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (1-METHYL-1H-1,2,3-TRIAZOL-4-YL)METHANOL |
CAS: | 77177-21-0 |
English Synonyms: | (1-METHYL-1H-1,2,3-TRIAZOL-4-YL)METHANOL |
MDL Number.: | MFCD13190019 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cn1cc(nn1)CO |
InChi: | InChI=1S/C4H7N3O/c1-7-2-4(3-8)5-6-7/h2,8H,3H2,1H3 |
InChiKey: | InChIKey=XKKMMJLWDOKNEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.