* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-AMINO-4'-CHLORO-[1,1'-BIPHENYL]-3-OL |
CAS: | 927408-14-8 |
English Synonyms: | 5-AMINO-4'-CHLORO-[1,1'-BIPHENYL]-3-OL ; [1,1'-BIPHENYL]-3-OL, 5-AMINO-4'-CHLORO- |
MDL Number.: | MFCD13191938 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc(ccc1c2cc(cc(c2)O)N)Cl |
InChi: | InChI=1S/C12H10ClNO/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-7,15H,14H2 |
InChiKey: | InChIKey=ZNGFKWPFSQZBKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.