* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DIHYDRO-SPIRO[BICYCLO[2.2.2]OCTANE-2,2'(5'H)-FURAN]-5'-ONE |
CAS: | 135974-89-9 |
English Synonyms: | SPIRO[BICYCLO[2.2.2]OCTANE-2,2'(5'H)-FURAN]-5'-ONE, DIHYDRO- ; DIHYDRO-SPIRO[BICYCLO[2.2.2]OCTANE-2,2'(5'H)-FURAN]-5'-ONE |
MDL Number.: | MFCD13192485 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CC2CCC1CC23CCC(=O)O3 |
InChi: | InChI=1S/C11H16O2/c12-10-5-6-11(13-10)7-8-1-3-9(11)4-2-8/h8-9H,1-7H2 |
InChiKey: | InChIKey=BPLYBQXYBWIUAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.