* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DATOLITE |
English Synonyms: | DATOLITE |
MDL Number.: | MFCD13194134 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | B1(O[Ca]O[Si]1=O)O |
InChi: | InChI=1S/BHO4Si.Ca/c2-1(3)6(4)5;/h2H;/q-2;+2 |
InChiKey: | InChIKey=DHYOKAJQNJTODG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.