* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INOLITAZONE |
| CAS: | 223132-37-4 |
| English Synonyms: | INOLITAZONE |
| MDL Number.: | MFCD13194772 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | Cc1cc(cc(c1N)C)Oc2ccc3c(c2)[nH]c(n3)COc4ccc(cc4)CC5C(=O)NC(=O)S5 |
| InChi: | InChI=1S/C26H24N4O4S/c1-14-9-19(10-15(2)24(14)27)34-18-7-8-20-21(12-18)29-23(28-20)13-33-17-5-3-16(4-6-17)11-22-25(31)30-26(32)35-22/h3-10,12,22H,11,13,27H2,1-2H3,(H,28,29)(H,30,31,32) |
| InChiKey: | InChIKey=SNETWQBXQADBNS-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.