* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RADEZOLID |
CAS: | 869884-78-6 |
English Synonyms: | RADEZOLID |
MDL Number.: | MFCD13194946 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | CC(=O)NC[C@H]1CN(C(=O)O1)c2ccc(cc2F)c3ccc(cc3)CNCc4cnn[nH]4 |
InChi: | InChI=1S/C22H23FN6O3/c1-14(30)25-12-19-13-29(22(31)32-19)21-7-6-17(8-20(21)23)16-4-2-15(3-5-16)9-24-10-18-11-26-28-27-18/h2-8,11,19,24H,9-10,12-13H2,1H3,(H,25,30)(H,26,27,28)/t19-/m0/s1 |
InChiKey: | InChIKey=LRDCTIKEZGQIDZ-IBGZPJMESA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.