* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SPIRO[PIPERIDINE-4,4'-PYRIDO[2,3-D][1,3]OXAZIN]-2'(1'H)-ONE |
CAS: | 753440-87-8 |
English Synonyms: | SPIRO[PIPERIDINE-4,4'-PYRIDO[2,3-D][1,3]OXAZIN]-2'(1'H)-ONE |
MDL Number.: | MFCD13195370 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc2c(nc1)NC(=O)OC23CCNCC3 |
InChi: | InChI=1S/C11H13N3O2/c15-10-14-9-8(2-1-5-13-9)11(16-10)3-6-12-7-4-11/h1-2,5,12H,3-4,6-7H2,(H,13,14,15) |
InChiKey: | InChIKey=HNGKYJPFWVQZSF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.