* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIAZOLO[5,4-D]PYRIMIDIN-7-OL |
CAS: | 5021-50-1 |
English Synonyms: | THIAZOLO[5,4-D]PYRIMIDIN-7-OL ; [1,3]THIAZOLO[5,4-D]PYRIMIDIN-7-OL |
MDL Number.: | MFCD13195519 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1nc(c2c(n1)scn2)O |
InChi: | InChI=1S/C5H3N3OS/c9-4-3-5(7-1-6-4)10-2-8-3/h1-2H,(H,6,7,9) |
InChiKey: | InChIKey=LCCSENBGKDLDAP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.