* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TERT-BUTYL 2-(4-METHYL-1,3-THIAZOL-2-YL)ACETATE |
| English Synonyms: | TERT-BUTYL 2-(4-METHYL-1,3-THIAZOL-2-YL)ACETATE |
| MDL Number.: | MFCD13196011 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1csc(n1)CC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C10H15NO2S/c1-7-6-14-8(11-7)5-9(12)13-10(2,3)4/h6H,5H2,1-4H3 |
| InChiKey: | InChIKey=MLQVUFYQYRTZBT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.