* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CYCLOPROPYL-3,9-DIAZABICYCLO[4.2.1]NONAN-4-ONE |
English Synonyms: | 9-CYCLOPROPYL-3,9-DIAZABICYCLO[4.2.1]NONAN-4-ONE |
MDL Number.: | MFCD13196556 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1CC1N2[C@H]3CC[C@@H]2CNC(=O)C3 |
InChi: | InChI=1S/C10H16N2O/c13-10-5-8-3-4-9(6-11-10)12(8)7-1-2-7/h7-9H,1-6H2,(H,11,13)/t8-,9+/m0/s1 |
InChiKey: | InChIKey=RFRSNTYIFVBMJA-DTWKUNHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.