* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-CYCLOPROPYL-9-AZABICYCLO[3.3.1]NONAN-3-OL |
| English Synonyms: | 9-CYCLOPROPYL-9-AZABICYCLO[3.3.1]NONAN-3-OL |
| MDL Number.: | MFCD13196565 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C1C[C@@H]2CC(C[C@H](C1)N2C3CC3)O |
| InChi: | InChI=1S/C11H19NO/c13-11-6-9-2-1-3-10(7-11)12(9)8-4-5-8/h8-11,13H,1-7H2/t9-,10+,11? |
| InChiKey: | InChIKey=FJYOGAGPRKFZII-ZACCUICWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.