* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 809862 |
English Synonyms: | TOSLAB 809862 |
MDL Number.: | MFCD13196602 |
H bond acceptor: | 11 |
H bond donor: | 3 |
Smile: | CC1CC(=O)Nc2cc(ccc2N1C(=O)C)N/N=N/c3ccc4c(c3)N(C(CC(=O)N4)C)C(=O)C |
InChi: | InChI=1S/C24H27N7O4/c1-13-9-24(35)26-20-11-17(6-8-21(20)30(13)15(3)32)27-29-28-18-5-7-19-22(12-18)31(16(4)33)14(2)10-23(34)25-19/h5-8,11-14H,9-10H2,1-4H3,(H,25,34)(H,26,35)(H,27,28) |
InChiKey: | InChIKey=NWOLDKRVJJVOTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.