* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 828256 |
English Synonyms: | TOSLAB 828256 |
MDL Number.: | MFCD13196608 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | CNC(=O)c1c2n(nn1)CCn3c(c(nn3)C(=O)NC)S2 |
InChi: | InChI=1S/C10H12N8O2S/c1-11-7(19)5-9-17(15-13-5)3-4-18-10(21-9)6(14-16-18)8(20)12-2/h3-4H2,1-2H3,(H,11,19)(H,12,20) |
InChiKey: | InChIKey=UGRUYQNBHZCJHR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.