* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 828257 |
English Synonyms: | TOSLAB 828257 |
MDL Number.: | MFCD13196609 |
H bond acceptor: | 12 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)CN2CCC(CC2)NC(=O)c3c4n(nn3)CCn5c(c(nn5)C(=O)NC6CCN(CC6)Cc7ccccc7)S4 |
InChi: | InChI=1S/C32H38N10O2S/c43-29(33-25-11-15-39(16-12-25)21-23-7-3-1-4-8-23)27-31-41(37-35-27)19-20-42-32(45-31)28(36-38-42)30(44)34-26-13-17-40(18-14-26)22-24-9-5-2-6-10-24/h1-10,25-26H,11-22H2,(H,33,43)(H,34,44) |
InChiKey: | InChIKey=GTHLCDVLXKOOTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.