* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 879698 |
English Synonyms: | TOSLAB 879698 |
MDL Number.: | MFCD13196620 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | C1CCCC(CC1)NC(=O)c2c3n(nn2)CCn4c(c(nn4)C(=O)NC5CCCCCC5)S3 |
InChi: | InChI=1S/C22H32N8O2S/c31-19(23-15-9-5-1-2-6-10-15)17-21-29(27-25-17)13-14-30-22(33-21)18(26-28-30)20(32)24-16-11-7-3-4-8-12-16/h15-16H,1-14H2,(H,23,31)(H,24,32) |
InChiKey: | InChIKey=PMYMTDHKHFIOKF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.