* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 879699 |
English Synonyms: | TOSLAB 879699 |
MDL Number.: | MFCD13196621 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | c1cc(cc(c1)F)CNC(=O)c2c3n(nn2)CCn4c(c(nn4)C(=O)NCc5cccc(c5)F)S3 |
InChi: | InChI=1S/C22H18F2N8O2S/c23-15-5-1-3-13(9-15)11-25-19(33)17-21-31(29-27-17)7-8-32-22(35-21)18(28-30-32)20(34)26-12-14-4-2-6-16(24)10-14/h1-6,9-10H,7-8,11-12H2,(H,25,33)(H,26,34) |
InChiKey: | InChIKey=WZQVWCJCOLIHHH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.