Molecular Structure:
CCD No.:CCD02018924
SELENA SEL10320942
Formula:C9 H7 F3 N2 O2 S
MolWeight:264.226
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10320942 |
| English Synonyms： | SELENA SEL10320942 |
| MDL Number.： | MFCD13203985 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cc(cc(c1)S(=O)(=O)NCC#N)C(F)(F)F |
| InChi： | InChI=1S/C9H7F3N2O2S/c10-9(11,12)7-2-1-3-8(6-7)17(15,16)14-5-4-13/h1-3,6,14H,5H2 |
| InChiKey： | InChIKey=OZJCSHQWINWZHT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
