Molecular Structure:
CCD No.:CCD02019847
SELENA SEL10324373
Formula:C11 H15 Br N2 O2 S
MolWeight:319.221
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10324373 |
| English Synonyms： | SELENA SEL10324373 |
| MDL Number.： | MFCD13204913 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCCNC(=O)CN(C)C(=O)c1cc(sc1)Br |
| InChi： | InChI=1S/C11H15BrN2O2S/c1-3-4-13-10(15)6-14(2)11(16)8-5-9(12)17-7-8/h5,7H,3-4,6H2,1-2H3,(H,13,15) |
| InChiKey： | InChIKey=AZGBWOXLISTAGH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
