Molecular Structure:
CCD No.:CCD02027258
SELENA SEL10427127
Formula:C14 H20 N2 O
MolWeight:232.325
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10427127 |
| English Synonyms： | SELENA SEL10427127 |
| MDL Number.： | MFCD13212352 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | CC(C)[C@@H](C(=O)NCC1Cc2c1cccc2)N |
| InChi： | InChI=1S/C14H20N2O/c1-9(2)13(15)14(17)16-8-11-7-10-5-3-4-6-12(10)11/h3-6,9,11,13H,7-8,15H2,1-2H3,(H,16,17)/t11?,13-/m0/s1 |
| InChiKey： | InChIKey=YPBVCKPZIFZOKR-YUZLPWPTSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
