Molecular Structure:
CCD No.:CCD02027259
SELENA SEL10427129
Formula:C15 H22 N2 O
MolWeight:246.352
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10427129 |
| English Synonyms： | SELENA SEL10427129 |
| MDL Number.： | MFCD13212353 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | CC[C@H](C)[C@@H](C(=O)NCC1Cc2c1cccc2)N |
| InChi： | InChI=1S/C15H22N2O/c1-3-10(2)14(16)15(18)17-9-12-8-11-6-4-5-7-13(11)12/h4-7,10,12,14H,3,8-9,16H2,1-2H3,(H,17,18)/t10-,12?,14-/m0/s1 |
| InChiKey： | InChIKey=CSLBJKJNTAQDCH-QHSVJNGKSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
