Molecular Structure:
CCD No.:CCD02027261
SELENA SEL10427134
Formula:C13 H17 N3 O
MolWeight:231.297
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10427134 |
| English Synonyms： | SELENA SEL10427134 |
| MDL Number.： | MFCD13212355 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cc2c(nc1)CCN(C2)C(=O)[C@@H]3CCCN3 |
| InChi： | InChI=1S/C13H17N3O/c17-13(12-4-2-7-15-12)16-8-5-11-10(9-16)3-1-6-14-11/h1,3,6,12,15H,2,4-5,7-9H2/t12-/m0/s1 |
| InChiKey： | InChIKey=PNTKIFXGWYORQG-LBPRGKRZSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
