Molecular Structure:
CCD No.:CCD02027477
SELENA SEL10427687
Formula:C14 H21 N3 O S
MolWeight:279.406
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10427687 |
| English Synonyms： | SELENA SEL10427687 |
| MDL Number.： | MFCD13212571 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cscc1CN2CCN(CC2)C(=O)[C@@H]3CCCN3 |
| InChi： | InChI=1S/C14H21N3OS/c18-14(13-2-1-4-15-13)17-7-5-16(6-8-17)10-12-3-9-19-11-12/h3,9,11,13,15H,1-2,4-8,10H2/t13-/m0/s1 |
| InChiKey： | InChIKey=QSSSEWBBTUALJP-ZDUSSCGKSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
